Products 2708342-97-4
CAS 2708342-97-4 appears in our catalog under these names: (5S)-1,7-diazaspiro[4.4]nonane,dihydrochloride, 97%, 97%, (5S)-1,7-DIAZASPIRO[4.4]NONANE DIHYDROCHLORIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(5S)-1,7-diazaspiro[4.4]nonane;dihydrochloride (CAS 2708342-97-4) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (5S)-1,7-diazaspiro[4.4]nonane;dihydrochloride. InChIKey: WATXVKXAFDYVLK-KLXURFKVSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (5S)-1,7-diazaspiro[4.4]nonane;dihydrochloride |
| InChIKey | WATXVKXAFDYVLK-KLXURFKVSA-N |
| SMILES | C1C[C@@]2(CCNC2)NC1.Cl.Cl |
Computed by PubChem (NCBI)