CAS 2708579-41-1 appears in our catalog under these names: N,N–didesmethyl U–47700 (trifluoroacetate salt) (CRM), N,N–didesmethyl U–47700 (trifluoroacetate salt). Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
N-[(1R,2R)-2-aminocyclohexyl]-3,4-dichloro-N-methylbenzamide;2,2,2-trifluoroacetic acid (CAS 2708579-41-1) is a chemical compound with the molecular formula C16H19Cl2F3N2O3 and a molecular weight of 415.2 g/mol. IUPAC name: N-[(1R,2R)-2-aminocyclohexyl]-3,4-dichloro-N-methylbenzamide;2,2,2-trifluoroacetic acid. InChIKey: UJUPTVGXIGIIGU-OJERSXHUSA-N.
| Molecular formula | C16H19Cl2F3N2O3 |
|---|---|
| Molecular weight | 415.2 g/mol |
| IUPAC name | N-[(1R,2R)-2-aminocyclohexyl]-3,4-dichloro-N-methylbenzamide;2,2,2-trifluoroacetic acid |
| InChIKey | UJUPTVGXIGIIGU-OJERSXHUSA-N |
| SMILES | CN([C@@H]1CCCC[C@H]1N)C(=O)C2=CC(=C(C=C2)Cl)Cl.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)