CAS 27087-06-5 appears in our catalog under these names: 5-Chloro-6-nitro-1,3-benzoxazol-2(3h)-one, 95%, 5-Chloro-6-nitrobenzo(d)oxazol-2(3H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 5g.
5-chloro-6-nitro-3H-1,3-benzoxazol-2-one (CAS 27087-06-5) is a chemical compound with the molecular formula C7H3ClN2O4 and a molecular weight of 214.56 g/mol. IUPAC name: 5-chloro-6-nitro-3H-1,3-benzoxazol-2-one. InChIKey: UXRRICZTIWOWDF-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O4 |
|---|---|
| Molecular weight | 214.56 g/mol |
| IUPAC name | 5-chloro-6-nitro-3H-1,3-benzoxazol-2-one |
| InChIKey | UXRRICZTIWOWDF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)[N+](=O)[O-])OC(=O)N2 |
Computed by PubChem (NCBI)