CAS 2710289-95-3 is the registry number for 2-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-1,2,3-triazole, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole (CAS 2710289-95-3) is a chemical compound with the molecular formula C10H18BN3O2 and a molecular weight of 223.08 g/mol. IUPAC name: 2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole. InChIKey: HABNJLRULUWLEB-UHFFFAOYSA-N.
| Molecular formula | C10H18BN3O2 |
|---|---|
| Molecular weight | 223.08 g/mol |
| IUPAC name | 2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
| InChIKey | HABNJLRULUWLEB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(N=C2)CC |
Computed by PubChem (NCBI)