CAS 2710510-11-3 is the registry number for N–methyl para–methyl Phenyl fentanyl (hydrochloride). Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
N-(4-methylphenyl)-N-(1-methylpiperidin-4-yl)benzamide;hydrochloride (CAS 2710510-11-3) is a chemical compound with the molecular formula C20H25ClN2O and a molecular weight of 344.9 g/mol. IUPAC name: N-(4-methylphenyl)-N-(1-methylpiperidin-4-yl)benzamide;hydrochloride. InChIKey: POXSKWLGKLXHAG-UHFFFAOYSA-N.
| Molecular formula | C20H25ClN2O |
|---|---|
| Molecular weight | 344.9 g/mol |
| IUPAC name | N-(4-methylphenyl)-N-(1-methylpiperidin-4-yl)benzamide;hydrochloride |
| InChIKey | POXSKWLGKLXHAG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2CCN(CC2)C)C(=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)