Products 27109-47-3

CAS 27109-47-3 is the registry number for 2-Bromo-3-methylbutanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(2R)-2-bromo-3-methylbutanoyl chloride (CAS 27109-47-3) is a chemical compound with the molecular formula C5H8BrClO and a molecular weight of 199.47 g/mol. IUPAC name: (2R)-2-bromo-3-methylbutanoyl chloride. InChIKey: MVYUMPZRKNBHOP-SCSAIBSYSA-N.

Identity
Molecular formulaC5H8BrClO
Molecular weight199.47 g/mol
IUPAC name(2R)-2-bromo-3-methylbutanoyl chloride
InChIKeyMVYUMPZRKNBHOP-SCSAIBSYSA-N
SMILESCC(C)[C@H](C(=O)Cl)Br

Computed by PubChem (NCBI)