CAS 2711603-38-0 appears in our catalog under these names: Clozapine (hydrochloride), Clozapine (dihydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 25mg, 5mg, Get quote.
3-chloro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine;dihydrochloride (CAS 2711603-38-0) is a chemical compound with the molecular formula C18H21Cl3N4 and a molecular weight of 399.7 g/mol. IUPAC name: 3-chloro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine;dihydrochloride. InChIKey: FBIKVTKYNDDABY-UHFFFAOYSA-N.
| Molecular formula | C18H21Cl3N4 |
|---|---|
| Molecular weight | 399.7 g/mol |
| IUPAC name | 3-chloro-6-(4-methylpiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine;dihydrochloride |
| InChIKey | FBIKVTKYNDDABY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=C(C=CC(=C3)Cl)NC4=CC=CC=C42.Cl.Cl |
Computed by PubChem (NCBI)