CAS 2711616-12-3 appears in our catalog under these names: Pentabromoethylbenzene-13C6, >95% (HPLC), 1,2,3,4,5-Pentabromo-6-ethylbenzene-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg.
1,2,3,4,5-pentabromo-6-ethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 2711616-12-3) is a chemical compound with the molecular formula C8H5Br5 and a molecular weight of 506.60 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-ethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: FIAXCDIQXHJNIX-LSYAIDEBSA-N.
| Molecular formula | C8H5Br5 |
|---|---|
| Molecular weight | 506.60 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-ethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | FIAXCDIQXHJNIX-LSYAIDEBSA-N |
| SMILES | CC[13C]1=[13C]([13C](=[13C]([13C](=[13C]1Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)