CAS 2711753-52-3 appears in our catalog under these names: SUCNR1–IN–1, SUCNR1-IN-1, 99.39%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 25 mg, 10 mg, 1 mg, 5 mg.
2-[2-[[3-[4-chloro-2-fluoro-5-[(3R)-piperidin-3-yl]oxyphenyl]-2-fluorobenzoyl]amino]-5-fluorophenyl]acetic acid (CAS 2711753-52-3) is a chemical compound with the molecular formula C26H22ClF3N2O4 and a molecular weight of 518.9 g/mol. IUPAC name: 2-[2-[[3-[4-chloro-2-fluoro-5-[(3R)-piperidin-3-yl]oxyphenyl]-2-fluorobenzoyl]amino]-5-fluorophenyl]acetic acid. InChIKey: MOOARNYDOKGVQG-MRXNPFEDSA-N.
| Molecular formula | C26H22ClF3N2O4 |
|---|---|
| Molecular weight | 518.9 g/mol |
| IUPAC name | 2-[2-[[3-[4-chloro-2-fluoro-5-[(3R)-piperidin-3-yl]oxyphenyl]-2-fluorobenzoyl]amino]-5-fluorophenyl]acetic acid |
| InChIKey | MOOARNYDOKGVQG-MRXNPFEDSA-N |
| SMILES | C1C[C@H](CNC1)OC2=C(C=C(C(=C2)C3=C(C(=CC=C3)C(=O)NC4=C(C=C(C=C4)F)CC(=O)O)F)F)Cl |
Computed by PubChem (NCBI)