Products 2712126-51-5
CAS 2712126-51-5 appears in our catalog under these names: Cystamine–d8 (hydrochloride), Cystamine-d8 2HCl, 99 atom % D, min 98% Chemical Purity, Cystamine-d8 (dihydrochloride). Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 5mg, 0,05g, 0,01g, 1mg, 10mg, 500μg, 1 mg.
2-[(2-amino-1,1,2,2-tetradeuterioethyl)disulfanyl]-1,1,2,2-tetradeuterioethanamine;dihydrochloride (CAS 2712126-51-5) is a chemical compound with the molecular formula C4H14Cl2N2S2 and a molecular weight of 233.3 g/mol. IUPAC name: 2-[(2-amino-1,1,2,2-tetradeuterioethyl)disulfanyl]-1,1,2,2-tetradeuterioethanamine;dihydrochloride. InChIKey: YUFRRMZSSPQMOS-VHGLFXLXSA-N.
| Molecular formula | C4H14Cl2N2S2 |
|---|---|
| Molecular weight | 233.3 g/mol |
| IUPAC name | 2-[(2-amino-1,1,2,2-tetradeuterioethyl)disulfanyl]-1,1,2,2-tetradeuterioethanamine;dihydrochloride |
| InChIKey | YUFRRMZSSPQMOS-VHGLFXLXSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])SSC([2H])([2H])C([2H])([2H])N)N.Cl.Cl |
Computed by PubChem (NCBI)