Products 2713446-71-8
CAS 2713446-71-8 appears in our catalog under these names: Pyrene-PEG3-azide, 98%, N-(2-(2-(2-(2-Azidoethoxy)ethoxy)ethoxy)ethyl)pyrene-1-carboxamide, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 5mg, 10mg, 25mg.
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]pyrene-1-carboxamide (CAS 2713446-71-8) is a chemical compound with the molecular formula C25H26N4O4 and a molecular weight of 446.5 g/mol. IUPAC name: N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]pyrene-1-carboxamide. InChIKey: YYHWYXUFODUASG-UHFFFAOYSA-N.
| Molecular formula | C25H26N4O4 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]pyrene-1-carboxamide |
| InChIKey | YYHWYXUFODUASG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C(=O)NCCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)
Synonyms:
Pyrene -PEG3-azide