CAS 2713623-12-0 is the registry number for 5,5-Dimethyl-2-(4-tricyclo[3.3.1.13,7]dec-1-ylphenyl)-1,3,2-dioxaborinane, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[4-(1-adamantyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane (CAS 2713623-12-0) is a chemical compound with the molecular formula C21H29BO2 and a molecular weight of 324.3 g/mol. IUPAC name: 2-[4-(1-adamantyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: VORMWQSFEZFTDD-UHFFFAOYSA-N.
| Molecular formula | C21H29BO2 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 2-[4-(1-adamantyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | VORMWQSFEZFTDD-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C34CC5CC(C3)CC(C5)C4 |
Computed by PubChem (NCBI)