CAS 27144-18-9 appears in our catalog under these names: 3-Tritylsulfanylpropionic Acid, >95% (HPLC), 3–Tritylmercapto–Propionicacid, 3-MPA(Trt), 3-(Tritylthio)propionic acid, 97% , 3-(Tritylthio)propionic acid. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 25g, 50g, 1g, 250g, 5g, 500g, 1000g.
3-tritylsulfanylpropanoic acid (CAS 27144-18-9) is a chemical compound with the molecular formula C22H20O2S and a molecular weight of 348.5 g/mol. IUPAC name: 3-tritylsulfanylpropanoic acid. InChIKey: AECGEIVNZGQBJT-UHFFFAOYSA-N.
| Molecular formula | C22H20O2S |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 3-tritylsulfanylpropanoic acid |
| InChIKey | AECGEIVNZGQBJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCCC(=O)O |
Computed by PubChem (NCBI)