CAS 2714409-29-5 appears in our catalog under these names: Fluazifop-butyl-d9, Fluazifop-butyl D9 100 µg/mL in Acetone. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 5mg, 1ml.
1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate (CAS 2714409-29-5) is a chemical compound with the molecular formula C19H20F3NO4 and a molecular weight of 392.4 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate. InChIKey: VAIZTNZGPYBOGF-OVYZNUIFSA-N.
| Molecular formula | C19H20F3NO4 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| InChIKey | VAIZTNZGPYBOGF-OVYZNUIFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OC(=O)C(C)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)