CAS 2714413-20-2 appears in our catalog under these names: Dicofol-D8, >95% (HPLC), Dicofol D8 100 µg/mL in Cyclohexane, D8-Dicofol, D8-Dicofol, Concentration: 100 µg/ml Solvent: Cyclohexane. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 0,5mg, 1mg, 5mg, 1ml, 1x10mg, 1x1ml.
2,2,2-trichloro-1,1-bis(4-chloro-2,3,5,6-tetradeuteriophenyl)ethanol (CAS 2714413-20-2) is a chemical compound with the molecular formula C14H9Cl5O and a molecular weight of 378.5 g/mol. IUPAC name: 2,2,2-trichloro-1,1-bis(4-chloro-2,3,5,6-tetradeuteriophenyl)ethanol. InChIKey: UOAMTSKGCBMZTC-PGRXLJNUSA-N.
| Molecular formula | C14H9Cl5O |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | 2,2,2-trichloro-1,1-bis(4-chloro-2,3,5,6-tetradeuteriophenyl)ethanol |
| InChIKey | UOAMTSKGCBMZTC-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])(C(Cl)(Cl)Cl)O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)