CAS 2714414-00-1 is the registry number for D-Homocysteine-d4. Offered by: TRC. Available pack sizes: 5mg.
(2R)-2-amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid (CAS 2714414-00-1) is a chemical compound with the molecular formula C4H9NO2S and a molecular weight of 139.21 g/mol. IUPAC name: (2R)-2-amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid. InChIKey: FFFHZYDWPBMWHY-ADHRGRJKSA-N.
| Molecular formula | C4H9NO2S |
|---|---|
| Molecular weight | 139.21 g/mol |
| IUPAC name | (2R)-2-amino-3,3,4,4-tetradeuterio-4-sulfanylbutanoic acid |
| InChIKey | FFFHZYDWPBMWHY-ADHRGRJKSA-N |
| SMILES | [2H]C([2H])([C@H](C(=O)O)N)C([2H])([2H])S |
Computed by PubChem (NCBI)