CAS 2714435-98-8 appears in our catalog under these names: Erythritol-d6, >95% (HPLC), meso-Erythritol-1,1,2,3,4,4-d6, 99 atom % D, min 98% Chemical Purity, meso-Erythritol-d6. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 0,1g, 0,05g, 5 mg, 10 mg, 1 mg.
(2S,3R)-1,1,2,3,4,4-hexadeuteriobutane-1,2,3,4-tetrol (CAS 2714435-98-8) is a chemical compound with the molecular formula C4H10O4 and a molecular weight of 128.16 g/mol. IUPAC name: (2S,3R)-1,1,2,3,4,4-hexadeuteriobutane-1,2,3,4-tetrol. InChIKey: UNXHWFMMPAWVPI-OYOWYGRISA-N.
| Molecular formula | C4H10O4 |
|---|---|
| Molecular weight | 128.16 g/mol |
| IUPAC name | (2S,3R)-1,1,2,3,4,4-hexadeuteriobutane-1,2,3,4-tetrol |
| InChIKey | UNXHWFMMPAWVPI-OYOWYGRISA-N |
| SMILES | [2H][C@@]([C@@]([2H])(C([2H])([2H])O)O)(C([2H])([2H])O)O |
Computed by PubChem (NCBI)