CAS 2714436-33-4 is the registry number for p-O-Methyl-isoproterenol-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
5-[1-hydroxy-2-(propan-2-ylamino)ethyl]-2-(trideuteriomethoxy)phenol;hydrochloride (CAS 2714436-33-4) is a chemical compound with the molecular formula C12H20ClNO3 and a molecular weight of 264.76 g/mol. IUPAC name: 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]-2-(trideuteriomethoxy)phenol;hydrochloride. InChIKey: GOVVCAGTQKEWNW-FJCVKDQNSA-N.
| Molecular formula | C12H20ClNO3 |
|---|---|
| Molecular weight | 264.76 g/mol |
| IUPAC name | 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]-2-(trideuteriomethoxy)phenol;hydrochloride |
| InChIKey | GOVVCAGTQKEWNW-FJCVKDQNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C(CNC(C)C)O)O.Cl |
Computed by PubChem (NCBI)