CAS 27148-03-4 appears in our catalog under these names: Benzo[d]isothiazole-3(2h)-thione 1,1-dioxide, 95%, Benzo(d)isothiazole–3(2H)–thione 1,1–dioxide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100mg.
1,1-dioxo-1,2-benzothiazole-3-thione (CAS 27148-03-4) is a chemical compound with the molecular formula C7H5NO2S2 and a molecular weight of 199.3 g/mol. IUPAC name: 1,1-dioxo-1,2-benzothiazole-3-thione. InChIKey: BAVQVWLILLHJKA-UHFFFAOYSA-N.
| Molecular formula | C7H5NO2S2 |
|---|---|
| Molecular weight | 199.3 g/mol |
| IUPAC name | 1,1-dioxo-1,2-benzothiazole-3-thione |
| InChIKey | BAVQVWLILLHJKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=S)NS2(=O)=O |
Computed by PubChem (NCBI)