Products 2715-36-8
CAS 2715-36-8 is the registry number for 1,2:3,4-Di-O-isopropylidene-6-O-methacryloyl-a-D-galactopyranose. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 25g, 10g.
(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl 2-methylprop-2-enoate (CAS 2715-36-8) is a chemical compound with the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. IUPAC name: (4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl 2-methylprop-2-enoate. InChIKey: RKFOJTMVZFAYQE-UHFFFAOYSA-N.
| Molecular formula | C16H24O7 |
|---|---|
| Molecular weight | 328.36 g/mol |
| IUPAC name | (4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl 2-methylprop-2-enoate |
| InChIKey | RKFOJTMVZFAYQE-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC1C2C(C3C(O1)OC(O3)(C)C)OC(O2)(C)C |
Computed by PubChem (NCBI)
Synonyms:
6-O-Methacryloyl-1,2, mAGP