CAS 2715225-19-5 is the registry number for Antimalarial agent 46. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(methylamino)ethyl]-1-(3,4,5-trichlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide (CAS 2715225-19-5) is a chemical compound with the molecular formula C21H17Cl3N4O and a molecular weight of 447.7 g/mol. IUPAC name: N-[2-(methylamino)ethyl]-1-(3,4,5-trichlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide. InChIKey: QMDRNRLEBOLLRB-UHFFFAOYSA-N.
| Molecular formula | C21H17Cl3N4O |
|---|---|
| Molecular weight | 447.7 g/mol |
| IUPAC name | N-[2-(methylamino)ethyl]-1-(3,4,5-trichlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| InChIKey | QMDRNRLEBOLLRB-UHFFFAOYSA-N |
| SMILES | CNCCNC(=O)C1=NC(=C2C(=C1)C3=CC=CC=C3N2)C4=CC(=C(C(=C4)Cl)Cl)Cl |
Computed by PubChem (NCBI)