CAS 2715284-61-8 appears in our catalog under these names: 8-Bromo-2-(ethylthio)-3,6-dimethyl-4H-chromen-4-one, 97%, 8-bromo-2-ethylsulfanyl-3,6-dimethyl-chromen-4-one, 97%, 97%, 8-bromo-2-ethylsulfanyl-3,6-dimethyl-chromen-4-one, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
8-bromo-2-ethylsulfanyl-3,6-dimethylchromen-4-one (CAS 2715284-61-8) is a chemical compound with the molecular formula C13H13BrO2S and a molecular weight of 313.21 g/mol. IUPAC name: 8-bromo-2-ethylsulfanyl-3,6-dimethylchromen-4-one. InChIKey: IFFGWNJSWAGSRI-UHFFFAOYSA-N.
| Molecular formula | C13H13BrO2S |
|---|---|
| Molecular weight | 313.21 g/mol |
| IUPAC name | 8-bromo-2-ethylsulfanyl-3,6-dimethylchromen-4-one |
| InChIKey | IFFGWNJSWAGSRI-UHFFFAOYSA-N |
| SMILES | CCSC1=C(C(=O)C2=C(O1)C(=CC(=C2)C)Br)C |
Computed by PubChem (NCBI)