CAS 2716848-82-5 is the registry number for cis-hexahydro-1H-pyrrolo[3,2-b]pyrrol-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 25mg.
(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-5-one (CAS 2716848-82-5) is a chemical compound with the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. IUPAC name: (3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-5-one. InChIKey: DSILUGCORMLHPA-WHFBIAKZSA-N.
| Molecular formula | C6H10N2O |
|---|---|
| Molecular weight | 126.16 g/mol |
| IUPAC name | (3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrol-5-one |
| InChIKey | DSILUGCORMLHPA-WHFBIAKZSA-N |
| SMILES | C1CN[C@@H]2[C@H]1NC(=O)C2 |
Computed by PubChem (NCBI)