CAS 2717-39-7 appears in our catalog under these names: 1,4,5,8-Tetramethylnaphthalene, 95%, 1,4,5,8-Tetramethylnaphthalene, 1,4,5,8-Tetramethylnaphthalene, min. 95 %, 100 mg, 1,4,5,8-Tetramethylnaphthalene, min. 95 %, 250 mg, 1,4,5,8-Tetramethylnaphthalene, min. 95 %, 500 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 2000mg, 1g.
1,4,5,8-tetramethylnaphthalene (CAS 2717-39-7) is a chemical compound with the molecular formula C14H16 and a molecular weight of 184.28 g/mol. IUPAC name: 1,4,5,8-tetramethylnaphthalene. InChIKey: DWUSGRRPJCRNCI-UHFFFAOYSA-N.
| Molecular formula | C14H16 |
|---|---|
| Molecular weight | 184.28 g/mol |
| IUPAC name | 1,4,5,8-tetramethylnaphthalene |
| InChIKey | DWUSGRRPJCRNCI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C(C2=C(C=C1)C)C)C |
Computed by PubChem (NCBI)