Products 2717598-89-3
CAS 2717598-89-3 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(6-phenylpyridin-3-yl)propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-phenyl-3-pyridinyl)propanoic acid (CAS 2717598-89-3) is a chemical compound with the molecular formula C29H24N2O4 and a molecular weight of 464.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-phenyl-3-pyridinyl)propanoic acid. InChIKey: LYOLIFJQWDNJIC-UHFFFAOYSA-N.
| Molecular formula | C29H24N2O4 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-phenyl-3-pyridinyl)propanoic acid |
| InChIKey | LYOLIFJQWDNJIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=C2)CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)