CAS 2719031-29-3 is the registry number for 1-Fluorothioxanthen-9-one, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-fluorothioxanthen-9-one (CAS 2719031-29-3) is a chemical compound with the molecular formula C13H7FOS and a molecular weight of 230.26 g/mol. IUPAC name: 1-fluorothioxanthen-9-one. InChIKey: BGTXAWCQSFRFPW-UHFFFAOYSA-N.
| Molecular formula | C13H7FOS |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-fluorothioxanthen-9-one |
| InChIKey | BGTXAWCQSFRFPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC=C3S2)F |
Computed by PubChem (NCBI)