CAS 2719062-75-4 is the registry number for Methyl 2-{bis[(tert-butoxy)carbonyl]amino}-3-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-chlorobenzoate (CAS 2719062-75-4) is a chemical compound with the molecular formula C18H24ClNO6 and a molecular weight of 385.8 g/mol. IUPAC name: methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-chlorobenzoate. InChIKey: CXSGRTZFHHEDHM-UHFFFAOYSA-N.
| Molecular formula | C18H24ClNO6 |
|---|---|
| Molecular weight | 385.8 g/mol |
| IUPAC name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-chlorobenzoate |
| InChIKey | CXSGRTZFHHEDHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(C=CC=C1Cl)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)