Products 2719726-03-9

CAS 2719726-03-9 is the registry number for 1-(Difluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(difluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid (CAS 2719726-03-9) is a chemical compound with the molecular formula C8H12F2O4 and a molecular weight of 210.17 g/mol. IUPAC name: 1-(difluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid. InChIKey: DZWRSMLBRRQUAF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12F2O4
Molecular weight210.17 g/mol
IUPAC name1-(difluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid
InChIKeyDZWRSMLBRRQUAF-UHFFFAOYSA-N
SMILESCOC1(CC(C1)(C(F)F)C(=O)O)OC

Computed by PubChem (NCBI)