CAS 2719726-03-9 is the registry number for 1-(Difluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(difluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid (CAS 2719726-03-9) is a chemical compound with the molecular formula C8H12F2O4 and a molecular weight of 210.17 g/mol. IUPAC name: 1-(difluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid. InChIKey: DZWRSMLBRRQUAF-UHFFFAOYSA-N.
| Molecular formula | C8H12F2O4 |
|---|---|
| Molecular weight | 210.17 g/mol |
| IUPAC name | 1-(difluoromethyl)-3,3-dimethoxycyclobutane-1-carboxylic acid |
| InChIKey | DZWRSMLBRRQUAF-UHFFFAOYSA-N |
| SMILES | COC1(CC(C1)(C(F)F)C(=O)O)OC |
Computed by PubChem (NCBI)