CAS 2719749-28-5 appears in our catalog under these names: (Rac)–RP–6306, (Rac)-RP-6306, 99%, 99%, (Rac)-lunresertib, 99.72%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 1mg, 10 mg, 50 mg, 25 mg, 10mM/1mL.
2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide (CAS 2719749-28-5) is a chemical compound with the molecular formula C18H20N4O2 and a molecular weight of 324.4 g/mol. IUPAC name: 2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide. InChIKey: ARBRHWRTXPWZGN-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide |
| InChIKey | ARBRHWRTXPWZGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)C)N2C(=C(C3=C2N=C(C(=C3)C)C)C(=O)N)N |
Computed by PubChem (NCBI)