CAS 27205-99-8 is the registry number for Sodium O,O-Diisopropyl Dithiophosphate. Offered by: TRC. Available pack sizes: 10g.
Sodium di(propan-2-yloxy)-sulfanylidene-sulfido-lambda5-phosphane (CAS 27205-99-8) is a chemical compound with the molecular formula C6H14NaO2PS2 and a molecular weight of 236.3 g/mol. IUPAC name: sodium di(propan-2-yloxy)-sulfanylidene-sulfido-lambda5-phosphane. InChIKey: ZRNMDYDECQBXQW-UHFFFAOYSA-M.
| Molecular formula | C6H14NaO2PS2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | sodium di(propan-2-yloxy)-sulfanylidene-sulfido-lambda5-phosphane |
| InChIKey | ZRNMDYDECQBXQW-UHFFFAOYSA-M |
| SMILES | CC(C)OP(=S)(OC(C)C)[S-].[Na+] |
Computed by PubChem (NCBI)