CAS 27213-61-2 is the registry number for 1H-Perfluoroheptane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane (CAS 27213-61-2) is a chemical compound with the molecular formula C7HF15 and a molecular weight of 370.06 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane. InChIKey: HBZVXKDQRIQMCW-UHFFFAOYSA-N.
| Molecular formula | C7HF15 |
|---|---|
| Molecular weight | 370.06 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane |
| InChIKey | HBZVXKDQRIQMCW-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)