CAS 2724247-43-0 is the registry number for Potassium 4-(2-methoxyethylamine-1-carbonyl)phenyltrifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Potassium trifluoro-[4-(2-methoxyethylcarbamoyl)phenyl]boranuide (CAS 2724247-43-0) is a chemical compound with the molecular formula C10H12BF3KNO2 and a molecular weight of 285.11 g/mol. IUPAC name: potassium trifluoro-[4-(2-methoxyethylcarbamoyl)phenyl]boranuide. InChIKey: HOIRNIUHFHDIIW-UHFFFAOYSA-N.
| Molecular formula | C10H12BF3KNO2 |
|---|---|
| Molecular weight | 285.11 g/mol |
| IUPAC name | potassium trifluoro-[4-(2-methoxyethylcarbamoyl)phenyl]boranuide |
| InChIKey | HOIRNIUHFHDIIW-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)C(=O)NCCOC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)