CAS 2724616-61-7 is the registry number for 3-(tert-Butyl)-4-methoxyphenol-13C6. Offered by: TRC. Available pack sizes: 10mg.
3-tert-butyl-4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 2724616-61-7) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 186.20 g/mol. IUPAC name: 3-tert-butyl-4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: IMOYOUMVYICGCA-CYRQOIGNSA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 3-tert-butyl-4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | IMOYOUMVYICGCA-CYRQOIGNSA-N |
| SMILES | CC(C)(C)[13C]1=[13C]([13CH]=[13CH][13C](=[13CH]1)O)OC |
Computed by PubChem (NCBI)