CAS 2724689-26-1 is the registry number for Levomepromazine Sulfone N-Oxide (Levomepromazine N,S,S-Trioxide). Offered by: Mikromol. Available pack sizes: 25mg.
(2S)-3-(2-methoxy-5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine oxide (CAS 2724689-26-1) is a chemical compound with the molecular formula C19H24N2O4S and a molecular weight of 376.5 g/mol. IUPAC name: (2S)-3-(2-methoxy-5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine oxide. InChIKey: UUOHRDSNBFFKHG-AWEZNQCLSA-N.
| Molecular formula | C19H24N2O4S |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | (2S)-3-(2-methoxy-5,5-dioxophenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine oxide |
| InChIKey | UUOHRDSNBFFKHG-AWEZNQCLSA-N |
| SMILES | C[C@@H](CN1C2=CC=CC=C2S(=O)(=O)C3=C1C=C(C=C3)OC)C[N+](C)(C)[O-] |
Computed by PubChem (NCBI)