CAS 2724689-54-5 is the registry number for Brompheniramine N-Oxide Dihydrochloride. Offered by: Mikromol. Available pack sizes: 100mg.
3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide;hydrochloride (CAS 2724689-54-5) is a chemical compound with the molecular formula C16H20BrClN2O and a molecular weight of 371.7 g/mol. IUPAC name: 3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide;hydrochloride. InChIKey: KMXIBLNZBKDQBR-UHFFFAOYSA-N.
| Molecular formula | C16H20BrClN2O |
|---|---|
| Molecular weight | 371.7 g/mol |
| IUPAC name | 3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide;hydrochloride |
| InChIKey | KMXIBLNZBKDQBR-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC(C1=CC=C(C=C1)Br)C2=CC=CC=N2)[O-].Cl |
Computed by PubChem (NCBI)