Products 2724690-02-0
CAS 2724690-02-0 is the registry number for Melperone N-Oxide. Offered by: Mikromol. Available pack sizes: 25mg.
1-(4-fluorophenyl)-4-(4-methyl-1-oxidopiperidin-1-ium-1-yl)butan-1-one (CAS 2724690-02-0) is a chemical compound with the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. IUPAC name: 1-(4-fluorophenyl)-4-(4-methyl-1-oxidopiperidin-1-ium-1-yl)butan-1-one. InChIKey: LCOHBSJSZNYNNQ-UHFFFAOYSA-N.
| Molecular formula | C16H22FNO2 |
|---|---|
| Molecular weight | 279.35 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4-(4-methyl-1-oxidopiperidin-1-ium-1-yl)butan-1-one |
| InChIKey | LCOHBSJSZNYNNQ-UHFFFAOYSA-N |
| SMILES | CC1CC[N+](CC1)(CCCC(=O)C2=CC=C(C=C2)F)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Melperone N-Oxide