CAS 2724726-50-3 is the registry number for Enrofloxacin Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Propan-2-yl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate (CAS 2724726-50-3) is a chemical compound with the molecular formula C22H28FN3O3 and a molecular weight of 401.5 g/mol. IUPAC name: propan-2-yl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate. InChIKey: LISZRBXNFGZGLX-UHFFFAOYSA-N.
| Molecular formula | C22H28FN3O3 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | propan-2-yl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate |
| InChIKey | LISZRBXNFGZGLX-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)OC(C)C)C4CC4)F |
Computed by PubChem (NCBI)