Products 2724726-55-8
CAS 2724726-55-8 is the registry number for Opipramol Di-N-Oxide. Offered by: Mikromol. Available pack sizes: 25mg.
2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)-1,4-dioxidopiperazine-1,4-diium-1-yl]ethanol (CAS 2724726-55-8) is a chemical compound with the molecular formula C23H29N3O3 and a molecular weight of 395.5 g/mol. IUPAC name: 2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)-1,4-dioxidopiperazine-1,4-diium-1-yl]ethanol. InChIKey: OWQZRCANFCVUII-UHFFFAOYSA-N.
| Molecular formula | C23H29N3O3 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | 2-[4-(3-benzo[b][1]benzazepin-11-ylpropyl)-1,4-dioxidopiperazine-1,4-diium-1-yl]ethanol |
| InChIKey | OWQZRCANFCVUII-UHFFFAOYSA-N |
| SMILES | C1C[N+](CC[N+]1(CCCN2C3=CC=CC=C3C=CC4=CC=CC=C42)[O-])(CCO)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Opipramol Di-N-Oxide