CAS 2724729-03-5 is the registry number for N-(2-Quinoxaline)-sulfaquinoxalin. Offered by: TRC. Available pack sizes: 10g.
N-quinoxalin-2-yl-4-(quinoxalin-2-ylamino)benzenesulfonamide (CAS 2724729-03-5) is a chemical compound with the molecular formula C22H16N6O2S and a molecular weight of 428.5 g/mol. IUPAC name: N-quinoxalin-2-yl-4-(quinoxalin-2-ylamino)benzenesulfonamide. InChIKey: SSJSJQLWQYBAKY-UHFFFAOYSA-N.
| Molecular formula | C22H16N6O2S |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | N-quinoxalin-2-yl-4-(quinoxalin-2-ylamino)benzenesulfonamide |
| InChIKey | SSJSJQLWQYBAKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)NC3=CC=C(C=C3)S(=O)(=O)NC4=NC5=CC=CC=C5N=C4 |
Computed by PubChem (NCBI)