CAS 2724765-95-9 is the registry number for 3-Aminopropyltriethoxysilane-13C3. Offered by: TRC. Available pack sizes: 25mg.
3-triethoxysilyl(1,2,3-13C3)propan-1-amine (CAS 2724765-95-9) is a chemical compound with the molecular formula C9H23NO3Si and a molecular weight of 224.35 g/mol. IUPAC name: 3-triethoxysilyl(1,2,3-13C3)propan-1-amine. InChIKey: WYTZZXDRDKSJID-ULEDQSHZSA-N.
| Molecular formula | C9H23NO3Si |
|---|---|
| Molecular weight | 224.35 g/mol |
| IUPAC name | 3-triethoxysilyl(1,2,3-13C3)propan-1-amine |
| InChIKey | WYTZZXDRDKSJID-ULEDQSHZSA-N |
| SMILES | CCO[Si]([13CH2][13CH2][13CH2]N)(OCC)OCC |
Computed by PubChem (NCBI)