CAS 2725316-94-7 is the registry number for (+)-erythro-Ethylnaphthidate Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
Ethyl (2R)-2-naphthalen-2-yl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride (CAS 2725316-94-7) is a chemical compound with the molecular formula C19H24ClNO2 and a molecular weight of 333.8 g/mol. IUPAC name: ethyl (2R)-2-naphthalen-2-yl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride. InChIKey: UOJLOHIHPJXBLW-CJRXIRLBSA-N.
| Molecular formula | C19H24ClNO2 |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | ethyl (2R)-2-naphthalen-2-yl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | UOJLOHIHPJXBLW-CJRXIRLBSA-N |
| SMILES | CCOC(=O)[C@@H]([C@@H]1CCCCN1)C2=CC3=CC=CC=C3C=C2.Cl |
Computed by PubChem (NCBI)