CAS 2725355-06-4 is the registry number for Hydroxychloroquine N-Oxide Dihydrochloride. Offered by: Mikromol. Available pack sizes: 10mg.
4-[(7-chloroquinolin-4-yl)amino]-N-ethyl-N-(2-hydroxyethyl)pentan-1-amine oxide;dihydrochloride (CAS 2725355-06-4) is a chemical compound with the molecular formula C18H28Cl3N3O2 and a molecular weight of 424.8 g/mol. IUPAC name: 4-[(7-chloroquinolin-4-yl)amino]-N-ethyl-N-(2-hydroxyethyl)pentan-1-amine oxide;dihydrochloride. InChIKey: ONHDVTLOHIYORH-UHFFFAOYSA-N.
| Molecular formula | C18H28Cl3N3O2 |
|---|---|
| Molecular weight | 424.8 g/mol |
| IUPAC name | 4-[(7-chloroquinolin-4-yl)amino]-N-ethyl-N-(2-hydroxyethyl)pentan-1-amine oxide;dihydrochloride |
| InChIKey | ONHDVTLOHIYORH-UHFFFAOYSA-N |
| SMILES | CC[N+](CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)(CCO)[O-].Cl.Cl |
Computed by PubChem (NCBI)