CAS 2725398-46-7 is the registry number for Perfluorododecanoic Acid-13C. Offered by: TRC. Available pack sizes: 2,5mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluoro(113C)dodecanoic acid (CAS 2725398-46-7) is a chemical compound with the molecular formula C12HF23O2 and a molecular weight of 615.09 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluoro(113C)dodecanoic acid. InChIKey: CXGONMQFMIYUJR-OUBTZVSYSA-N.
| Molecular formula | C12HF23O2 |
|---|---|
| Molecular weight | 615.09 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluoro(113C)dodecanoic acid |
| InChIKey | CXGONMQFMIYUJR-OUBTZVSYSA-N |
| SMILES | [13C](=O)(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)