Products 2725579-25-7
CAS 2725579-25-7 is the registry number for Trimeprazine N-Oxide Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg.
N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine oxide;hydrochloride (CAS 2725579-25-7) is a chemical compound with the molecular formula C18H23ClN2OS and a molecular weight of 350.9 g/mol. IUPAC name: N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine oxide;hydrochloride. InChIKey: KBMGDHDHDWBIOV-UHFFFAOYSA-N.
| Molecular formula | C18H23ClN2OS |
|---|---|
| Molecular weight | 350.9 g/mol |
| IUPAC name | N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine oxide;hydrochloride |
| InChIKey | KBMGDHDHDWBIOV-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)C[N+](C)(C)[O-].Cl |
Computed by PubChem (NCBI)