CAS 2725579-30-4 is the registry number for Dexchlorpheniramine n-Oxide Dihydrochloride. Offered by: TRC, Mikromol. Available pack sizes: 25mg, 100mg.
(3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide;dihydrochloride (CAS 2725579-30-4) is a chemical compound with the molecular formula C16H21Cl3N2O and a molecular weight of 363.7 g/mol. IUPAC name: (3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide;dihydrochloride. InChIKey: OHKSBZICVDICGZ-CKUXDGONSA-N.
| Molecular formula | C16H21Cl3N2O |
|---|---|
| Molecular weight | 363.7 g/mol |
| IUPAC name | (3S)-3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide;dihydrochloride |
| InChIKey | OHKSBZICVDICGZ-CKUXDGONSA-N |
| SMILES | C[N+](C)(CC[C@@H](C1=CC=C(C=C1)Cl)C2=CC=CC=N2)[O-].Cl.Cl |
Computed by PubChem (NCBI)