Products 2726423-31-8
CAS 2726423-31-8 is the registry number for Guanidine-15N3 (hydrobromide). Offered by: MedChemExpress. Available pack sizes: 1 mg.
Guanidine;hydrobromide (CAS 2726423-31-8) is a chemical compound with the molecular formula CH6BrN3 and a molecular weight of 142.96 g/mol. IUPAC name: guanidine;hydrobromide. InChIKey: VQNVZLDDLJBKNS-ZNYUTZBJSA-N.
| Molecular formula | CH6BrN3 |
|---|---|
| Molecular weight | 142.96 g/mol |
| IUPAC name | guanidine;hydrobromide |
| InChIKey | VQNVZLDDLJBKNS-ZNYUTZBJSA-N |
| SMILES | C(=[15NH])([15NH2])[15NH2].Br |
Computed by PubChem (NCBI)