Products 2726461-41-0
CAS 2726461-41-0 is the registry number for RNA splicing modulator 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2,7-dimethylindazol-5-yl)-3-piperidin-4-ylthieno[3,2-d]pyrimidin-4-one (CAS 2726461-41-0) is a chemical compound with the molecular formula C20H21N5OS and a molecular weight of 379.5 g/mol. IUPAC name: 6-(2,7-dimethylindazol-5-yl)-3-piperidin-4-ylthieno[3,2-d]pyrimidin-4-one. InChIKey: WSSAMTIMXZNENL-UHFFFAOYSA-N.
| Molecular formula | C20H21N5OS |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 6-(2,7-dimethylindazol-5-yl)-3-piperidin-4-ylthieno[3,2-d]pyrimidin-4-one |
| InChIKey | WSSAMTIMXZNENL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=CN(N=C12)C)C3=CC4=C(S3)C(=O)N(C=N4)C5CCNCC5 |
Computed by PubChem (NCBI)
Synonyms:
RNA splicing modulator 2, orb1982526