Products 2726926-25-4
CAS 2726926-25-4 is the registry number for Triclosan-13C6, 99.51%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
5-chloro-2-(2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyphenol (CAS 2726926-25-4) is a chemical compound with the molecular formula C12H7Cl3O2 and a molecular weight of 295.5 g/mol. IUPAC name: 5-chloro-2-(2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyphenol. InChIKey: XEFQLINVKFYRCS-SEAGLJPZSA-N.
| Molecular formula | C12H7Cl3O2 |
|---|---|
| Molecular weight | 295.5 g/mol |
| IUPAC name | 5-chloro-2-(2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyphenol |
| InChIKey | XEFQLINVKFYRCS-SEAGLJPZSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)O[13C]2=[13C]([13CH]=[13C]([13CH]=[13CH]2)Cl)Cl |
Computed by PubChem (NCBI)