CAS 2727060-96-8 appears in our catalog under these names: 4-Deschloro-3-chloro Sibutramine Hydrochloride, Sibutramine EP Impurity B. Offered by: TRC, Mikromol. Available pack sizes: 100mg, 25mg.
1-[1-(3-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride (CAS 2727060-96-8) is a chemical compound with the molecular formula C17H27Cl2N and a molecular weight of 316.3 g/mol. IUPAC name: 1-[1-(3-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride. InChIKey: HXTFBYZCFRQRRA-UHFFFAOYSA-N.
| Molecular formula | C17H27Cl2N |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 1-[1-(3-chlorophenyl)cyclobutyl]-N,N,3-trimethylbutan-1-amine;hydrochloride |
| InChIKey | HXTFBYZCFRQRRA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1(CCC1)C2=CC(=CC=C2)Cl)N(C)C.Cl |
Computed by PubChem (NCBI)