CAS 272786-64-8 appears in our catalog under these names: Unifiram, 95%, Unifiram, 2-((4-Fluorophenyl)sulfonyl)hexahydropyrrolo[1,2-a]pyrazin-6(2H)-one, Unifiram, 99.78%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 25mg, 50mg, 100mg, 500mg, 10mg.
2-(4-fluorophenyl)sulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (CAS 272786-64-8) is a chemical compound with the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. IUPAC name: 2-(4-fluorophenyl)sulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one. InChIKey: SNRTZFZAFBIBJP-UHFFFAOYSA-N.
| Molecular formula | C13H15FN2O3S |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 2-(4-fluorophenyl)sulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| InChIKey | SNRTZFZAFBIBJP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N2C1CN(CC2)S(=O)(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)